Iristectorigenin B [CAS 86849-77-6]
Partner: MedChemexpress LLC
CAS No: | 86849-77-6 |
Applications: | Neuroscience-Neuromodulation |
MW: | 330.29 |
Formula: | C17H14O7 |
SMILES: | O=C1C2=C(O)C(OC)=C(O)C=C2OC=C1C3=CC(O)=C(OC)C=C3 |
Purity: | 99.49 |
Description: | Iristectorigenin B (Iristectrigenin B) is a liver X receptor (LXR) modulator. Iristectrigenin B stimulates the transcriptional activity of both LXR-? and LXR-?[1]. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice