Iristectorigenin B [CAS 86849-77-6]
Partner: MedChemexpress LLC
| CAS No: | 86849-77-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 330.29 |
| Formula: | C17H14O7 |
| SMILES: | O=C1C2=C(O)C(OC)=C(O)C=C2OC=C1C3=CC(O)=C(OC)C=C3 |
| Purity: | 99.49 |
| Description: | Iristectorigenin B (Iristectrigenin B) is a liver X receptor (LXR) modulator. Iristectrigenin B stimulates the transcriptional activity of both LXR-? and LXR-?[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
