(+)-Schisandrin B [CAS 82467-52-5]
Partner: MedChemexpress LLC
| CAS No: | 82467-52-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 400.46 |
| Formula: | C23H28O6 |
| SMILES: | COC(C1=C(C=C2C[C@@H]3C)OCO1)=C2C4=C(C=C(C(OC)=C4OC)OC)C[C@H]3C.[R] |
| Purity: | 99.0 |
| Description: | (+)-Schisandrin B is an enantiomer of Schisandrin B. Schisandrin B is an active dibenzocyclooctadiene derivative isolated from the fruit of Schisandra chinensis, has antioxidant effect on rodent liver and heart[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
