(-)-Heraclenol [CAS 139079-42-8]
Partner: MedChemexpress LLC
| CAS No: | 139079-42-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 304.29 |
| Formula: | C16H16O6 |
| SMILES: | O=C1C=CC2=CC3=C(OC=C3)C(OC[C@H](O)C(C)(O)C)=C2O1 |
| Description: | (-)-Heraclenol is a derivative of furocoumarin isolated from Ducrosia anethifolia. (-)-Heraclenol shows antiproliferative and cytotoxic activities on cancer cell lines[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
