(�)-Stylopine (hydrochloride) [CAS 96087-21-7]
Partner: MedChemexpress LLC
| CAS No: | 96087-21-7 |
| Applications: | COVID-19-immunoregulation |
| MW: | 359.80 |
| Formula: | C19H18ClNO4 |
| SMILES: | [H]Cl.C1(C(CCN2CC3=C4OCOC4=CC=C3CC21)=C5)=CC6=C5OCO6 |
| Purity: | 99.66 |
| Description: | (�)-Stylopine (Tetrahydrocoptisine) hydrochloride is an alkaloid compound originally isolated from Corydalis tubers that exhibits anti-inflammatory and anti-parasitic activities[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
