(-)-Catechin [CAS 18829-70-4]
Partner: MedChemexpress LLC
| CAS No: | 18829-70-4 |
| Applications: | Cancer-programmed cell death |
| MW: | 290.27 |
| Formula: | C15H14O6 |
| SMILES: | O[C@H]1[C@H](C2=CC=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C3C1 |
| Purity: | 98.78 |
| Description: | (-)-Catechin is Catechin's one kind of different structure. Catechin inhibitory enzyme-1 (COX-1), IC50 ? 1.4 ?M. (-)-Catechin promotes hBM-MSC adipose cell differentiation, increases fat cell differentiation, and PPAR? level[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
