(-)-Bornyl acetate [CAS 5655-61-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 5655-61-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 196.29 |
| Formula: | C12H20O2 |
| SMILES: | CC1(C)[C@@]2(C)[C@H](OC(C)=O)C[C@]1([H])CC2 |
| Purity: | 95.0 |
| Description: | (-)-Bornyl acetate (L-(-)-Bornyl acetate), isolated from hyssop oil, is a less active enantiomer of (+)-Bornyl acetate. (-)-Bornyl acetate possesses antifungal activity[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
