Monotropein [CAS 5945-50-6]
Partner: MedChemexpress LLC
| CAS No: | 5945-50-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 390.34 |
| Formula: | C16H22O11 |
| SMILES: | O[C@H]([C@@H](O)[C@@H]1O)[C@](O[C@@H]1CO)([H])O[C@H]2[C@@]([C@@]3(O)CO)([H])[C@@](C=C3)([H])C(C(O)=O)=CO2 |
| Purity: | 99.09 |
| Description: | Monotropein is an iridoid glycoside isolated Morinda officinalis. Monotropein inhibits the expression of inflammatory mediators in dextran sulfate sodium (DSS)-induced colitis mouse model[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
