Rosarin [CAS 84954-93-8]
Partner: MedChemexpress LLC
| CAS No: | 84954-93-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 428.43 |
| Formula: | C20H28O10 |
| SMILES: | O[C@@H]([C@H](O)[C@H]1O)[C@H](O[C@H]1OC/C=C/C2=CC=CC=C2)CO[C@@H]3O[C@@H](CO)[C@H](O)[C@H]3O |
| Purity: | 99.94 |
| Description: | Rosarin is a cinnamyl alcohol�glycoside isolated from�Rhodiola rosea. Rosarin has anti-inflammatory and neuroprotective effects. Rosarin supresses the expression of the proinflammatory factors iNOS, IL-1�?, and TNF- ? in the kidney and prefrontal cortex of brain in mice�[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
