Sec-O-Glucosylhamaudol [CAS 80681-44-3]
Partner: MedChemexpress LLC
| CAS No: | 80681-44-3 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 438.43 |
| Formula: | C21H26O10 |
| SMILES: | CC([C@@H](O[C@]1([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2)(C)OC3=C2C(O)=C4C(OC(C)=CC4=O)=C3 |
| Purity: | 99.89 |
| Description: | Sec-O-Glucosylhamaudol is a natural compound extracted from Peucedanum japonicum Thunb, decreases levels of ?-opioid receptor, with analgesic effect[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
