Baicalin [CAS 21967-41-9]
Partner: MedChemexpress LLC
| CAS No: | 21967-41-9 |
| Applications: | COVID-19-anti-virus |
| MW: | 446.36 |
| Formula: | C21H18O11 |
| SMILES: | O[C@H]([C@H]([C@@H]([C@@H](C(O)=O)O1)O)O)[C@@H]1OC2=C(O)C(O)=C3C(C=C(C4=CC=CC=C4)OC3=C2)=O |
| Purity: | 99.17 |
| Description: | Baicalin, as a flavonoid glycoside, is an allosteric carnitine palmityl transferase 1 (CPT1) activator. Baicalin reduces the expression of NF-?B[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
