Dipotassium glycyrrhizinate [CAS 68797-35-3]
Partner: MedChemexpress LLC
| CAS No: | 68797-35-3 |
| Applications: | COVID-19-anti-virus |
| MW: | 899.11 |
| Formula: | C42H60K2O16 |
| SMILES: | C[C@]12[C@@](C(C=C3[C@]2(CC[C@]4(C)[C@@]3([H])C[C@](C(O[K])=O)(C)CC4)C)=O)([H])[C@@]5([C@@](C(C)([C@@H](O[C@]6([H])[C@@H]([C@H]([C@H](O)[C@@H](C(O)=O)O6)O)O[C@]7([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]7O)C(O[K])=O)CC5)C)([H])CC1)C |
| Purity: | 99.51 |
| Description: | Dipotassium glycyrrhizinate is a HMGB1 inhibitor, inhibits atopic dermatitis-related gene expression with anti-anti-inflammatory activity[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
