N6-Methyladenosine-d3 [CAS 139896-43-8]
Partner: MedChemexpress LLC
| CAS No: | 139896-43-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 284.29 |
| Formula: | C11H12D3N5O4 |
| SMILES: | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C(N=CN=C3NC([2H])([2H])[2H])=C3N=C2)O1 |
| Description: | N6-Methyladenosine-d3 (6-Methyladenosine-d3; N-Methyladenosine-d3) is a deuterium labeled N6-Methyladenosine (HY-N0086). N6-Methyladenosine is the most prevalent internal (non-cap) modification present in the messenger RNA (mRNA) of all higher eukaryotes. N6-Methyladenosine can modifies viral RNAs and has antiviral activities. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
