(E)-Ferulic acid-d3 [CAS 860605-59-0]
Partner: MedChemexpress LLC
| CAS No: | 860605-59-0 |
| MW: | 197.20 |
| Formula: | C10H7D3O4 |
| SMILES: | O=C(O)/C=C/C1=CC=C(O)C(OC([2H])([2H])[2H])=C1 |
| Purity: | 99.0 |
| Description: | (E)-Ferulic acid-d3 is the deuterium labeled (E)-Ferulic acid. (E)-Ferulic acid is a isomer of Ferulic acid which is an aromatic compound, abundant in plant cell walls. (E)-Ferulic acid causes the phosphorylation of ?-catenin, resulting in proteasomal degradation of ?-catenin and increases the expression of pro-apoptotic factor Bax and decreases the expression of pro-survival factor survivin. (E)-Ferulic acid shows a potent ability to remove reactive oxygen species (ROS) and inhibits lipid peroxidation. (E)-Ferulic acid exerts both anti-proliferation and anti-migration effects in the human lung cancer cell line H1299[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
