IR-806
Partner: MedChemexpress LLC
| MW: | 735.33 |
| Formula: | C37H44ClN2NaO6S2 |
| SMILES: | CC(C)(/C1=C/C=C2C(Cl)=C(CC/2)/C=C/C3=[N+](C4=C(C3(C)C)C=CC=C4)CCCCS(=O)(O[Na])=O)C5=C(C=CC=C5)N1CCCCS(=O)([O-])=O |
| Purity: | 97.0 |
| Description: | IR-806 is a near-infrared cyanine liquid crystal dye. IR-806 can be used as a molecular antenna to synthesized nanoprobes (NPs). IR-806 can be used for in vivo imaging studies[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
