BODIPY-581/591 NHS ester [CAS 150152-70-8]
Partner: MedChemexpress LLC
| CAS No: | 150152-70-8 |
| MW: | 489.28 |
| Formula: | C26H22BF2N3O4 |
| SMILES: | O=C(ON(C1=O)C(CC1)=O)CCC2=[N-]([B+3]([F-])([N]34)[F-])C(C=C2)=CC3=CC=C4/C=C/C=C/C5=CC=CC=C5 |
| Purity: | 99.0 |
| Description: | BODIPY-581/591 NHS ester is a bright, red fluorescent dye (excitation: 581 nm; emission: 591 nm). BODIPY-581/591 NHS ester shows unique hydrophobic properties for staining lipids, membranes, and other lipophilic compounds[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
