4-Di-10-ASP [CAS 95378-73-7]
Partner: MedChemexpress LLC
CAS No: | 95378-73-7 |
MW: | 618.72 |
Formula: | C34H55IN2 |
SMILES: | C[N+]1=CC=C(/C=C/C2=CC=C(N(CCCCCCCCCC)CCCCCCCCCC)C=C2)C=C1.[I-] |
Purity: | 98.0 |
Description: | 4-Di-10-ASP is a fluorescent lipophilic tracer (Excitation 485 nm; Emission 620 nm). 4-Di-10-ASP can be used to stain phospholipid membranes in a specific manner[1][2]. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice