Cyanine 5.5 azide [CAS 1557136-25-0]
Partner: MedChemexpress LLC
| CAS No: | 1557136-25-0 |
| MW: | 701.34 |
| Formula: | C43H49ClN6O |
| SMILES: | CN1C2=CC=C3C=CC=CC3=C2C(C)(C)/C1=C\C=C\C=C\C4=[N+](CCCCCC(NCCCN=[N+]=[N-])=O)C5=CC=C(C=CC=C6)C6=C5C4(C)C.[Cl-] |
| Purity: | 98.02 |
| Description: | Cyanine 5.5 azide (CY 5.5 azide) is a potent fluorescent dye. Cyanine 5.5 azide can label DNA. Cyanine 5.5 azide can be used for NIR live organism imaging. (?ex=684 nm, ?em=710 nm)[1][2]. Cyanine 5.5 azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
