Sulfo-Cy5 amine [CAS 2183440-44-8]
Partner: MedChemexpress LLC
| CAS No: | 2183440-44-8 |
| MW: | 740.97 |
| Formula: | C38H52N4O7S2 |
| SMILES: | O=C(CCCCC[N+]1=C(/C=C/C=C/C=C2N(C)C3=CC=C(S(=O)(O)=O)C=C3C\2(C)C)C(C)(C)C4=C1C=CC(S(=O)([O-])=O)=C4)NCCCCCCN |
| Purity: | 98.0 |
| Description: | Sulfo-Cy5 amine is a dye derivative of Cyanine 5 (Cy5) (HY-D0821) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy5 is a near-infrared fluorescent dye commonly used in biolabeling and cell imaging. The amine functionality of Sulfo-Cy5 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy5 amine can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
