Biotin-DADOO [CAS 138529-46-1]
Partner: MedChemexpress LLC
| CAS No: | 138529-46-1 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 374.50 |
| Formula: | C16H30N4O4S |
| SMILES: | O=C(NCCOCCOCCN)CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O |
| Purity: | 98.0 |
| Description: | Biotin-DADOO is a biotinylation reagent, which can be used to synthesize a biotin-estradiol conjugate (i.e., biotin-DADOO-estradiol) to develop a direct, broad range enzyme immunoassay to measure plasma estradiol concentrations. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
