H2DCFDA [CAS 4091-99-0] (10mM in DMSO)
Partner: MedChemexpress LLC
CAS No: | 4091-99-0 |
MW: | 487.29 |
Formula: | C24H16Cl2O7 |
SMILES: | O=C(O)C1=CC=CC=C1C2C3=C(OC4=C2C=C(Cl)C(OC(C)=O)=C4)C=C(OC(C)=O)C(Cl)=C3 |
Purity: | 99.82 |
Description: | H2DCFDA (DCFH-DA) is a cell-permeable probe used to detect intracellular reactive oxygen species (ROS) (Ex/Em=488/525 nm)[1]. |
Shipping Conditions: | Ship on cold packs |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice