NBD-F [CAS 29270-56-2]
Partner: MedChemexpress LLC
| CAS No: | 29270-56-2 |
| MW: | 183.10 |
| Formula: | C6H2FN3O3 |
| SMILES: | O=[N+](C1=CC=C(F)C2=NON=C21)[O-] |
| Purity: | 98.0 |
| Description: | NBD-F (4-Fluoro-7-nitrobenzofurazan) is a pro-fluorescent reagent which is developed for amino acid analysis. NBD-F reacts with primary or secondary amines to produce a fluorescent product and used for analysis of amino acids and low molecular weight amines[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
