5(6)-Aminofluorescein [CAS 27599-63-9]
Partner: MedChemexpress LLC
| CAS No: | 27599-63-9 |
| MW: | 347.32 |
| Formula: | C20H13NO5 |
| SMILES: | NC(C=C1)=CC2=C1C3(OC2=O)C(C=CC(O)=C4)=C4OC5=C3C=CC(O)=C5.O=C(C6=C7C=C(N)C=C6)OC87C(C=CC(O)=C9)=C9OC%10=C8C=CC(O)=C%10 |
| Purity: | 98.09 |
| Description: | 5(6)-Aminofluorescein (5(6)-AFM) is a a precursor for synthesis of 5(6)-FITC (HY-15941). 5(6)-FITC is an amine-reactive derivative of fluorescein dye. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
