Captan-d6 [CAS 1330190-00-5]
Partner: MedChemexpress LLC
| CAS No: | 1330190-00-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 306.63 |
| Formula: | C9H2D6Cl3NO2S |
| SMILES: | ClC(Cl)(Cl)SN1C(C2C(C([2H])([2H])C([2H])=C([2H])C2([2H])[2H])C1=O)=O |
| Description: | Captan-d6 is the deuterium labeled Captan[1]. Captan is a common agricultural fungicide used to control Botrytis, Fusarium, Fusicoccum, Pythium. Captan enhances denitrifying and total culturable bacteria[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
