Carbadox [CAS 6804-07-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 6804-07-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 262.22 |
| Formula: | C11H10N4O4 |
| SMILES: | [O-][N+]1=C2C=CC=CC2=[N+]([O-])C(/C=N/NC(OC)=O)=C1 |
| Purity: | 98.0 |
| Description: | Carbadox is a quinoxaline-di-N-oxide antibiotic compound which is widely fed to nursery-age pigs to control enteric diseases and improve feed efficiency. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
