Bekanamycin [CAS 4696-76-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 4696-76-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 483.51 |
| Formula: | C18H37N5O10 |
| SMILES: | O[C@H]1[C@](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@@]3([H])O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)([H])O[C@H](CO)[C@@H](O)[C@@H]1N |
| Purity: | 98.0 |
| Description: | Bekanamycin (Kanamycin B) is an aminoglycoside antibiotic produced by Streptomyces kanamyceticus, against an array of Gram-positive and Gram-negative bacterial strain[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
