Sulbentine [CAS 350-12-9] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 350-12-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 314.47 |
| Formula: | C17H18N2S2 |
| SMILES: | S=C1SCN(CC2=CC=CC=C2)CN1CC3=CC=CC=C3 |
| Purity: | 99.37 |
| Description: | Sulbentine (Dibenzthione) is an azole antifungal agent that has fungistatic and fungicidal activities. Sulbentine is used as a locally acting antimycotic in vivo[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
