Methicillin (sodium salt) [CAS 132-92-3] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 132-92-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 402.40 |
| Formula: | C17H19N2NaO6S |
| SMILES: | O=C([C@H](N1C2=O)C(C)(S[C@@]1([C@@H]2NC(C3=C(C=CC=C3OC)OC)=O)[H])C)O[Na] |
| Purity: | 98.12 |
| Description: | Methicillin sodium salt (Meticillin sodium) is a β-lactam, semi-synthetic antibiotic related to penicillin antibiotic. Methicillin sodium salt inhibits penicillin-binding proteins involved in the synthesis of peptidoglycan. Methicillin sodium salt inhibits S. aureus with a MIC value of 2.1 μg/mL. Methicillin sodium salt can be used for the research of inflammation[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
