Acetamiprid [CAS 135410-20-7]
Partner: MedChemexpress LLC
| CAS No: | 135410-20-7 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 222.68 |
| Formula: | C10H11ClN4 |
| SMILES: | C/C(N(CC1=CC=C(Cl)N=C1)C)=N\C#N |
| Purity: | 99.88 |
| Description: | Acetamiprid is a neonicotinoid insecticide used worldwide. Acetamiprid is a nicotinic acetylcholine receptor (nAChR) agonist, and is shown to be associated with neuromuscular and reproductive disorders[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
