Pyridaben-d13 [CAS 2468638-05-1]
Partner: MedChemexpress LLC
| CAS No: | 2468638-05-1 |
| MW: | 378.01 |
| Formula: | C19H12D13ClN2OS |
| SMILES: | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C(C([2H])=C1[2H])=C([2H])C([2H])=C1CSC2=C(C(N(N=C2)C(C)(C)C)=O)Cl |
| Description: | Pyridaben-d13 is the deuterium labeled Pyridaben[1]. Pyridaben is a mitochondrial electron transport inhibitor (METI) acaricide that promotes the formation of damaging oxygen and nitrogen radicals. Pyridaben selectively inhibits complex I (NADH dehydrogenase) with an IC50 value of 2.4 nM (assay sites: rat liver and bovine heart mitochondria). Pyridaben also significantly inhibits rat mitochondrial mtNOS function[2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
