Pyridaben [CAS 96489-71-3]
Partner: MedChemexpress LLC
| CAS No: | 96489-71-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 364.93 |
| Formula: | C19H25ClN2OS |
| SMILES: | O=C1C(Cl)=C(SCC2=CC=C(C(C)(C)C)C=C2)C=NN1C(C)(C)C |
| Purity: | 99.27 |
| Description: | Pyridaben is a mitochondrial electron transport inhibitor (METI) acaricide that promotes the formation of damaging oxygen and nitrogen radicals. Pyridaben selectively inhibits complex I (NADH dehydrogenase) with an IC50 value of 2.4 nM (assay sites: rat liver and bovine heart mitochondria). Pyridaben also significantly inhibits rat mitochondrial mtNOS function[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
