Nifekalant (hydrochloride) [CAS 130656-51-8]
Partner: MedChemexpress LLC
| CAS No: | 130656-51-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 441.91 |
| Formula: | C19H28ClN5O5 |
| SMILES: | [H]Cl.O=C1N(C)C(C=C(NCCN(CCO)CCCC2=CC=C([N+]([O-])=O)C=C2)N1C)=O |
| Purity: | 99.92 |
| Description: | Nifekalant hydrochloride (MS-551), a class III antiarrhythmic agent, is a IKr potassium channel blocker with an IC50 of 10 �M. Nifekalant hydrochloride can be used for refractory ventricular tachyarrhythmias research[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
