(2R,4R)-4-Hydroxypyrrolidine-2-carboxylic acid hydrochloride [CAS 77449-94-6]
Partner: MedChemexpress LLC
| CAS No: | 77449-94-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 167.59 |
| Formula: | C5H10ClNO3 |
| SMILES: | OC([C@H]1C[C@H](CN1)O)=O.Cl |
| Purity: | 98.0 |
| Description: | cis-4-Hydroxy-D-proline hydrochloride is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). cis-4-Hydroxy-D-proline hydrochloride is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
