G9a-IN-1 [CAS 1350752-07-6]
Partner: MedChemexpress LLC
CAS No: | 1350752-07-6 |
Applications: | COVID-19-immunoregulation |
MW: | 462.03 |
Formula: | C24H36ClN5O2 |
SMILES: | CC(N1CCC(NC2=C3C=C(OC)C(OCCCN4CCCC4)=CC3=NC(Cl)=N2)CC1)C |
Purity: | 98.12 |
Description: | G9a-IN-1 (Compound 113) is a G9a protein inhibitor. G9A/EHMT2 is a nuclear histone lysine methyltransferase that catalyzes histone H3 lysine 9 dimethylation (H3K9me2), which is a reversible modification generally associated with transcriptional gene silencing. G9a-IN-1 can be used for the research of autoimmune disorders or cancer[1]. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice