1-Boc-azetidine-3-carboxylic acid [CAS 142253-55-2]
Partner: MedChemexpress LLC
| CAS No: | 142253-55-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 201.22 |
| Formula: | C9H15NO4 |
| SMILES: | O=C(C1CN(C(OC(C)(C)C)=O)C1)O |
| Purity: | 98.0 |
| Description: | 1-Boc-azetidine-3-carboxylic acid is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). 1-Boc-azetidine-3-carboxylic acid is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[2]</sup |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
