Artemisone [CAS 255730-18-8]
Partner: MedChemexpress LLC
| CAS No: | 255730-18-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 401.52 |
| Formula: | C19H31NO6S |
| SMILES: | C[C@H]1[C@H](N2CCS(CC2)(=O)=O)O[C@@]3([H])[C@]45[C@@]([C@H](C)CC[C@]51[H])([H])CC[C@@](O3)(C)OO4 |
| Purity: | 98.0 |
| Description: | Artemisone (Artemifone) is a potent and semi-synthetic antimalarial, inhibits P. falciparum strains, with a mean IC50 of 0.83 nM[1]. Artemisone is also a potent inhibitor of human CMV[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
