(R)-Tegoprazan [CAS 942195-56-4]
Partner: MedChemexpress LLC
| CAS No: | 942195-56-4 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 387.38 |
| Formula: | C20H19F2N3O3 |
| SMILES: | CN(C)C(C1=CC(O[C@H]2C3=C(F)C=C(F)C=C3OCC2)=C4C(N=C(N4)C)=C1)=O |
| Purity: | 99.73 |
| Description: | (R)-Tegoprazan ((R)-CJ-12420; example 3), a benzimidazole derivative, is a potent kidney H+/K+-ATPase inhibitor with an IC50 of 98 nM of canine kidney Na+/K+-ATPase. (R)-Tegoprazan has the potential for gastrointestinal diseases research[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
