Garenoxacin (Mesylate hydrate) [CAS 223652-90-2]
Partner: MedChemexpress LLC
| CAS No: | 223652-90-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 540.53 |
| Formula: | C24H26F2N2O8S |
| SMILES: | O=C(C1=CN(C2CC2)C3=C(C=CC(C4=CC5=C([C@@H](C)NC5)C=C4)=C3OC(F)F)C1=O)O.CS(=O)(O)=O.O |
| Purity: | 99.78 |
| Description: | Garenoxacin (BMS284756) Mesylate hydrate is an orally active quinolone antibiotic and has a broad spectrum of activity against a wide array of gram-positive and gram-negative bacteria, anaerobes, and fastidious organisms[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
