OICR-0547 [CAS 1801873-49-3]
Partner: MedChemexpress LLC
| CAS No: | 1801873-49-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 542.55 |
| Formula: | C28H29F3N4O4 |
| SMILES: | O=C(C1=CNC(C=C1C(F)(F)F)=O)NC2=CC(C3=CC(CN4CCOCC4)=CC=C3)=CC=C2N5CCOCC5 |
| Purity: | 99.93 |
| Description: | OICR-0547 is a negative control, closely related derivative of OICR-9429 (HY-16993). OICR-9429 is a novel small-molecule antagonist of the Wdr5-MLL interaction. OICR-0547 is an inactive control compound that no longer binds to WDR5[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
