Irinotecan-d10 (hydrochloride) [CAS 718612-62-5]
Partner: MedChemexpress LLC
| CAS No: | 718612-62-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 633.20 |
| Formula: | C33H29D10ClN4O6 |
| SMILES: | C(C)C1=C2C(C=3N(C2)C(=O)C4=C(C3)[C@](CC)(O)C(=O)OC4)=NC=5C1=CC(OC(=O)N6CCC(CC6)N7C(C(C(C(C7([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])=CC5.Cl |
| Purity: | 98.02 |
| Description: | Irinotecan-d10 (hydrochloride) is the deuterium labeled Irinotecan. Irinotecan ((+)-Irinotecan) is a topoisomerase I inhibitor, preventing religation of the DNA strand by binding to topoisomerase I-DNA complex[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
