Irinotecan (hydrochloride) [CAS 100286-90-6]
Partner: MedChemexpress LLC
| CAS No: | 100286-90-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 623.14 |
| Formula: | C33H39ClN4O6 |
| SMILES: | O=C(N1CCC(N2CCCCC2)CC1)OC3=CC=C4N=C5C(CN6C(C(COC([C@@]7(CC)O)=O)=C7C=C65)=O)=C(CC)C4=C3.[H]Cl |
| Purity: | 99.75 |
| Description: | Irinotecan hydrochloride ((+)-Irinotecan hydrochloride) is a topoisomerase I inhibitor mainly used to treat colon cancer and rectal cancer[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
