Irinotecan [CAS 97682-44-5]
Partner: MedChemexpress LLC
| CAS No: | 97682-44-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 586.68 |
| Formula: | C33H38N4O6 |
| SMILES: | O=C(N1CCC(N2CCCCC2)CC1)OC3=CC=C4N=C5C(CN6C(C(COC([C@@]7(CC)O)=O)=C7C=C65)=O)=C(CC)C4=C3 |
| Purity: | 99.84 |
| Description: | Irinotecan ((+)-Irinotecan) is a topoisomerase I inhibitor, preventing religation of the DNA strand by binding to topoisomerase I-DNA complex[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
