NB-598 (Maleate) [CAS 155294-62-5]
Partner: MedChemexpress LLC
| CAS No: | 155294-62-5 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 565.74 |
| Formula: | C31H35NO5S2 |
| SMILES: | O=C(O)/C=C\C(O)=O.CC(C)(C)C#C/C=C/CN(CC)CC1=CC(OCC2=CC(C3=CSC=C3)=CS2)=CC=C1 |
| Purity: | 99.48 |
| Description: | NB-598 Maleate is a potent and competitive inhibitor of squalene epoxidase (SE), and suppresses triglyceride biosynthesis through the farnesol pathway. NB-598 (Maleate) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
