NB-598 [CAS 131060-14-5]
Partner: MedChemexpress LLC
| CAS No: | 131060-14-5 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 449.67 |
| Formula: | C27H31NOS2 |
| SMILES: | CCN(C/C=C/C#CC(C)(C)C)CC1=CC=CC(OCC2=CC(C3=CSC=C3)=CS2)=C1 |
| Purity: | 98.29 |
| Description: | NB-598 is a potent and competitive inhibitor of squalene epoxidase (SE), and suppresses triglyceride biosynthesis through the farnesol pathway. NB-598 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
