AM095 (free acid) [CAS 1228690-36-5]
Partner: MedChemexpress LLC
| CAS No: | 1228690-36-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 456.49 |
| Formula: | C27H24N2O5 |
| SMILES: | O=C(O)CC1=CC=C(C2=CC=C(C3=C(NC(O[C@@H](C4=CC=CC=C4)C)=O)C(C)=NO3)C=C2)C=C1 |
| Purity: | 98.24 |
| Description: | AM095 (free acid) is a potent LPA1 receptor antagonist with IC50 values of 0.98 and 0.73 ?M for recombinant human or mouse LPA1 respectively. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
