Sal003 [CAS 1164470-53-4]
Partner: MedChemexpress LLC
| CAS No: | 1164470-53-4 |
| Applications: | Cancer-Kinase/protease |
| MW: | 463.21 |
| Formula: | C18H15Cl4N3OS |
| SMILES: | O=C(NC(NC(NC1=CC=C(Cl)C=C1)=S)C(Cl)(Cl)Cl)/C=C/C2=CC=CC=C2 |
| Purity: | 99.21 |
| Description: | Sal003 is a potent, specific and cell-permeable inhibitor of the eukaryotic translation initiation factor 2? (eIF2?) phosphatase. Sal003 is a derivative of salubrinal[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
