5-FAM SE [CAS 92557-80-7]
Partner: MedChemexpress LLC
| CAS No: | 92557-80-7 |
| MW: | 473.39 |
| Formula: | C25H15NO9 |
| SMILES: | O=C(C1=CC2=C(C3(C4=C(OC5=C3C=CC(O)=C5)C=C(O)C=C4)OC2=O)C=C1)ON6C(CCC6=O)=O |
| Purity: | 98.64 |
| Description: | 5-FAM SE is a single isomer, is a fluorescent labeling reagent used for labeling peptides, proteins and nucleotides. 5-FAM SE can react with amines and can yield stable amine conjugates[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
