TBHBA [CAS 14348-40-4]
Partner: MedChemexpress LLC
| CAS No: | 14348-40-4 |
| MW: | 374.81 |
| Formula: | C7H3Br3O3 |
| SMILES: | O=C(O)C1=C(Br)C=C(Br)C(O)=C1Br |
| Purity: | 99.78 |
| Description: | TBHBA (2,4,6-Tribromo-3-hydroxybenzoic acid) is produced by reacting with 4-aminoantipyrine (4-AA) or 3-methylbenzothiazole in the presence of hydrogen peroxide and peroxidase. Oxidative coupling reaction of methylone hydrazone (MBTH) to form highly stable dyes. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
