Nitro blue tetrazolium chloride [CAS 298-83-9]
Partner: MedChemexpress LLC
| CAS No: | 298-83-9 |
| MW: | 817.64 |
| Formula: | C40H30Cl2N10O6 |
| SMILES: | COC1=CC(C2=CC=C(N3N=C(C4=CC=CC=C4)N=[N+]3C5=CC=C([N+]([O-])=O)C=C5)C(OC)=C2)=CC=C1N6N=C(C7=CC=CC=C7)N=[N+]6C8=CC=C([N+]([O-])=O)C=C8.[Cl-].[Cl-] |
| Purity: | 99.82 |
| Description: | Nitro blue tetrazolium chloride (NBT) is a substrate for dehydrogenases; is used with the alkaline phosphatase substrate 5-Bromo-4-Chloro-3-Indolyl Phosphate (BCIP) in western blotting and immunohistological staining procedures. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
