AG-825 [CAS 149092-50-2]
Partner: MedChemexpress LLC
| CAS No: | 149092-50-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 397.47 |
| Formula: | C19H15N3O3S2 |
| SMILES: | O=C(N)/C(C#N)=C/C1=CC(OC)=C(O)C(CSC2=NC3=CC=CC=C3S2)=C1 |
| Purity: | 98.02 |
| Description: | AG-825 (Tyrphostin AG-825) is a selective and ATP-competitive ErbB2 inhibitor which suppresses tyrosine phosphorylation, with an IC50 of 0.35 ?M. AG-825 displays anti-cancer activity[1][2][3]. AG825 significantly accelerates apoptosis of human neutrophils[4]. AG-825 is a potential agent for overcoming Mn-induced neurotoxicity or AD development[5]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
